C35H41Cl2N3O7 — CID 23807193
tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(4-methoxyphenyl)ethylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23807193) has the molecular formula C35H41Cl2N3O7 and a molecular weight of 686.63 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(4-methoxyphenyl)ethylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(4-methoxyphenyl)ethylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23807193 |
| Molecular Formula | C35H41Cl2N3O7 |
| Molecular Weight | 686.63 g/mol |
| Exact Mass | 685.23 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(4-methoxyphenyl)ethylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1ccc(CCNNC(=O)[C@@]2(CCC(=O)OC(C)(C)C)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C35H41Cl2N3O7/c1-34(2,3)47-30(42)16-18-35(33(43)40-38-19-17-23-6-11-26(44-4)12-7-23)31(28-15-10-25(36)22-29(28)37)46-32(39-35)24-8-13-27(14-9-24)45-21-5-20-41/h6-15,22,31,38,41H,5,16-21H2,1-4H3,(H,40,43)/t31-,35-/m0/s1 |
| InChIKey | DXYKGQSIRLNAJQ-ZJJOJAIXSA-N |
| XLogP | 6.01 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|