C37H40BrN3O6 — CID 23975878
tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23975878) has the molecular formula C37H40BrN3O6 and a molecular weight of 702.65 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23975878 |
| Molecular Formula | C37H40BrN3O6 |
| Molecular Weight | 702.65 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCc2cccc3ccccc23)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C37H40BrN3O6/c1-36(2,3)47-32(43)20-21-37(35(44)41-39-24-28-10-6-9-25-8-4-5-11-31(25)28)33(26-12-16-29(38)17-13-26)46-34(40-37)27-14-18-30(19-15-27)45-23-7-22-42/h4-6,8-19,33,39,42H,7,20-24H2,1-3H3,(H,41,44)/t33-,37-/m0/s1 |
| InChIKey | LHASCQLPWIJPHS-WNOXWKSXSA-N |
| XLogP | 6.56 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|