C46H49N3O6 — CID 23777339
tert-butyl 3-[(4S,5S)-4-[(2,2-diphenylethylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23777339) has the molecular formula C46H49N3O6 and a molecular weight of 739.91 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-4-[(2,2-diphenylethylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-4-[(2,2-diphenylethylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23777339 |
| Molecular Formula | C46H49N3O6 |
| Molecular Weight | 739.91 g/mol |
| Exact Mass | 739.36 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-4-[(2,2-diphenylethylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCC(c2ccccc2)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H49N3O6/c1-45(2,3)55-41(51)28-29-46(44(52)49-47-32-40(35-16-9-5-10-17-35)36-18-11-6-12-19-36)42(37-22-20-34(21-23-37)33-14-7-4-8-15-33)54-43(48-46)38-24-26-39(27-25-38)53-31-13-30-50/h4-12,14-27,40,42,47,50H,13,28-32H2,1-3H3,(H,49,52)/t42-,46-/m0/s1 |
| InChIKey | ARWLYYKAIITJBF-HCQHVFLSSA-N |
| XLogP | 7.95 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.91 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|