C29H38BrN3O8 — CID 23919254
tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-4-[(1,3-dihydroxypropan-2-ylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23919254) has the molecular formula C29H38BrN3O8 and a molecular weight of 636.54 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-4-[(1,3-dihydroxypropan-2-ylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-4-[(1,3-dihydroxypropan-2-ylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23919254 |
| Molecular Formula | C29H38BrN3O8 |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(4-bromophenyl)-4-[(1,3-dihydroxypropan-2-ylamino)carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNC(CO)CO)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H38BrN3O8/c1-28(2,3)41-24(37)13-14-29(27(38)33-32-22(17-35)18-36)25(19-5-9-21(30)10-6-19)40-26(31-29)20-7-11-23(12-8-20)39-16-4-15-34/h5-12,22,25,32,34-36H,4,13-18H2,1-3H3,(H,33,38)/t25-,29-/m0/s1 |
| InChIKey | HZYHXNISNVCDAC-SVEHJYQDSA-N |
| XLogP | 2.56 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|