C21H30N2O7 — CID 23748833
tert-butyl 3-[(4S,5S)-4-(hydroxycarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23748833) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-4-(hydroxycarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-4-(hydroxycarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23748833 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-4-(hydroxycarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | C[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(CCC(=O)OC(C)(C)C)C(=O)NO |
| InChI | InChI=1S/C21H30N2O7/c1-14-21(19(26)23-27,11-10-17(25)30-20(2,3)4)22-18(29-14)15-6-8-16(9-7-15)28-13-5-12-24/h6-9,14,24,27H,5,10-13H2,1-4H3,(H,23,26)/t14-,21-/m0/s1 |
| InChIKey | RKPNDTCXELVSPQ-QKKBWIMNSA-N |
| XLogP | 1.98 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|