C34H38N2O6 — CID 23778093
tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23778093) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23778093 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | C[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(CCC(=O)OC(C)(C)C)C(=O)NC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H38N2O6/c1-22-34(19-18-29(38)42-33(2,3)4,36-31(41-22)23-14-16-24(17-15-23)40-21-9-20-37)32(39)35-30-27-12-7-5-10-25(27)26-11-6-8-13-28(26)30/h5-8,10-17,22,30,37H,9,18-21H2,1-4H3,(H,35,39)/t22-,34-/m1/s1 |
| InChIKey | ZXVNFBQUDAALMX-GMWXTNTRSA-N |
| XLogP | 5.36 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|