C40H42N2O7 — CID 23749320
tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23749320) has the molecular formula C40H42N2O7 and a molecular weight of 662.78 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23749320 |
| Molecular Formula | C40H42N2O7 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-4-(9H-fluoren-9-ylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(CCC(=O)OC(C)(C)C)C(=O)NC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C40H42N2O7/c1-39(2,3)49-34(44)21-22-40(38(45)41-35-32-15-7-5-13-30(32)31-14-6-8-16-33(31)35)36(27-11-9-12-29(25-27)46-4)48-37(42-40)26-17-19-28(20-18-26)47-24-10-23-43/h5-9,11-20,25,35-36,43H,10,21-24H2,1-4H3,(H,41,45)/t36-,40-/m1/s1 |
| InChIKey | DFFYOCGXSONXPF-ATUKEALCSA-N |
| XLogP | 6.72 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|