C31H37N3O6 — CID 23806269
tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23806269) has the molecular formula C31H37N3O6 and a molecular weight of 547.65 g/mol. Its IUPAC name is tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23806269 |
| Molecular Formula | C31H37N3O6 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(naphthalen-1-ylmethylamino)carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@]1(C(=O)NNCc2cccc3ccccc23)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C31H37N3O6/c1-30(2,3)40-27(36)16-17-31(21-39-28(33-31)23-12-14-25(15-13-23)38-19-7-18-35)29(37)34-32-20-24-10-6-9-22-8-4-5-11-26(22)24/h4-6,8-15,32,35H,7,16-21H2,1-3H3,(H,34,37)/t31-/m0/s1 |
| InChIKey | KCQZAGAQPCYWGD-HKBQPEDESA-N |
| XLogP | 4.06 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|