C23H35N3O6 — CID 23777828
tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-(propylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23777828) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-(propylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-(propylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23777828 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | tert-butyl 3-[(4S)-2-[4-(3-hydroxypropoxy)phenyl]-4-(propylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CCCNNC(=O)[C@]1(CCC(=O)OC(C)(C)C)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C23H35N3O6/c1-5-13-24-26-21(29)23(12-11-19(28)32-22(2,3)4)16-31-20(25-23)17-7-9-18(10-8-17)30-15-6-14-27/h7-10,24,27H,5-6,11-16H2,1-4H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | YNLVMJZQQDIGAO-QHCPKHFHSA-N |
| XLogP | 2.12 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|