C25H32BrN3O4 — CID 23891659
(4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891659) has the molecular formula C25H32BrN3O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891659 |
| Molecular Formula | C25H32BrN3O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CCCCCNNC(=O)[C@]1(Cc2ccccc2Br)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C25H32BrN3O4/c1-2-3-6-14-27-29-24(31)25(17-20-8-4-5-9-22(20)26)18-33-23(28-25)19-10-12-21(13-11-19)32-16-7-15-30/h4-5,8-13,27,30H,2-3,6-7,14-18H2,1H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | LCBMEGIDDGRNAB-VWLOTQADSA-N |
| XLogP | 3.78 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|