C28H30FN3O4 — CID 23834965
(4S)-4-benzyl-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23834965) has the molecular formula C28H30FN3O4 and a molecular weight of 491.56 g/mol. Its IUPAC name is (4S)-4-benzyl-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-benzyl-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23834965 |
| Molecular Formula | C28H30FN3O4 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (4S)-4-benzyl-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCCc1ccccc1F)[C@]1(Cc2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C28H30FN3O4/c29-25-10-5-4-9-22(25)15-16-30-32-27(34)28(19-21-7-2-1-3-8-21)20-36-26(31-28)23-11-13-24(14-12-23)35-18-6-17-33/h1-5,7-14,30,33H,6,15-20H2,(H,32,34)/t28-/m0/s1 |
| InChIKey | CTJWTOSGFYCVOR-NDEPHWFRSA-N |
| XLogP | 3.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|