C25H33N3O4 — CID 23777814
(4S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23777814) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23777814 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (4S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N'-pentyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CCCCCNNC(=O)[C@]1(Cc2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C25H33N3O4/c1-2-3-7-15-26-28-24(30)25(18-20-9-5-4-6-10-20)19-32-23(27-25)21-11-13-22(14-12-21)31-17-8-16-29/h4-6,9-14,26,29H,2-3,7-8,15-19H2,1H3,(H,28,30)/t25-/m0/s1 |
| InChIKey | ICVFJTAAPNUABR-VWLOTQADSA-N |
| XLogP | 3.02 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|