C29H32BrN3O4 — CID 23975152
(4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975152) has the molecular formula C29H32BrN3O4 and a molecular weight of 566.50 g/mol. Its IUPAC name is (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975152 |
| Molecular Formula | C29H32BrN3O4 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | (4S)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | Cc1ccc(CCNNC(=O)[C@]2(Cc3ccccc3Br)COC(c3ccc(OCCCO)cc3)=N2)cc1 |
| InChI | InChI=1S/C29H32BrN3O4/c1-21-7-9-22(10-8-21)15-16-31-33-28(35)29(19-24-5-2-3-6-26(24)30)20-37-27(32-29)23-11-13-25(14-12-23)36-18-4-17-34/h2-3,5-14,31,34H,4,15-20H2,1H3,(H,33,35)/t29-/m0/s1 |
| InChIKey | IFJOWARVXGYPJO-LJAQVGFWSA-N |
| XLogP | 4.14 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|