C28H29FN6O4 — CID 23806896
(4S)-4-[(2-azidophenyl)methyl]-N'-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806896) has the molecular formula C28H29FN6O4 and a molecular weight of 532.58 g/mol. Its IUPAC name is (4S)-4-[(2-azidophenyl)methyl]-N'-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(2-azidophenyl)methyl]-N'-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806896 |
| Molecular Formula | C28H29FN6O4 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (4S)-4-[(2-azidophenyl)methyl]-N'-[2-(4-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)NNCCc2ccc(F)cc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C28H29FN6O4/c29-23-10-6-20(7-11-23)14-15-31-34-27(37)28(18-22-4-1-2-5-25(22)33-35-30)19-39-26(32-28)21-8-12-24(13-9-21)38-17-3-16-36/h1-2,4-13,31,36H,3,14-19H2,(H,34,37)/t28-/m0/s1 |
| InChIKey | NMBMASFBBHNIQX-NDEPHWFRSA-N |
| XLogP | 4.15 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|