C26H26N6O4 — CID 23777853
(4S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-phenyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23777853) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is (4S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-phenyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-phenyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23777853 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (4S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-phenyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)NNc2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C26H26N6O4/c27-32-30-23-10-5-4-7-20(23)17-26(25(34)31-29-21-8-2-1-3-9-21)18-36-24(28-26)19-11-13-22(14-12-19)35-16-6-15-33/h1-5,7-14,29,33H,6,15-18H2,(H,31,34)/t26-/m0/s1 |
| InChIKey | KXOZZBSMIDGESX-SANMLTNESA-N |
| XLogP | 4.29 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|