C29H30Cl2N6O4 — CID 23947605
(4S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947605) has the molecular formula C29H30Cl2N6O4 and a molecular weight of 597.50 g/mol. Its IUPAC name is (4S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947605 |
| Molecular Formula | C29H30Cl2N6O4 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | (4S)-4-[[2-(azidomethyl)phenyl]methyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@@]1(C(=O)NNCCc2ccc(Cl)cc2Cl)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C29H30Cl2N6O4/c30-24-9-6-20(26(31)16-24)12-13-33-36-28(39)29(17-22-4-1-2-5-23(22)18-34-37-32)19-41-27(35-29)21-7-10-25(11-8-21)40-15-3-14-38/h1-2,4-11,16,33,38H,3,12-15,17-19H2,(H,36,39)/t29-/m0/s1 |
| InChIKey | MCCOFJHDQFXQDM-LJAQVGFWSA-N |
| XLogP | 5.19 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|