C42H42N6O6 — CID 23806241
(4S)-4-[(2-azidophenyl)methyl]-N'-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806241) has the molecular formula C42H42N6O6 and a molecular weight of 726.83 g/mol. Its IUPAC name is (4S)-4-[(2-azidophenyl)methyl]-N'-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(2-azidophenyl)methyl]-N'-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806241 |
| Molecular Formula | C42H42N6O6 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | (4S)-4-[(2-azidophenyl)methyl]-N'-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)NNCCc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C42H42N6O6/c43-48-46-37-15-8-7-14-35(37)27-42(30-54-40(45-42)34-17-19-36(20-18-34)51-25-9-24-49)41(50)47-44-23-22-31-16-21-38(52-28-32-10-3-1-4-11-32)39(26-31)53-29-33-12-5-2-6-13-33/h1-8,10-21,26,44,49H,9,22-25,27-30H2,(H,47,50)/t42-/m0/s1 |
| InChIKey | GSTNXMDFAPWENB-WBCKFURZSA-N |
| XLogP | 7.17 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|