C27H33N5O5 — CID 23835167
(4R)-4-[[2-(azidomethyl)phenyl]methyl]-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835167) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is (4R)-4-[[2-(azidomethyl)phenyl]methyl]-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-[[2-(azidomethyl)phenyl]methyl]-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835167 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (4R)-4-[[2-(azidomethyl)phenyl]methyl]-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NC2CCC(O)CC2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C27H33N5O5/c28-32-29-17-21-5-2-1-4-20(21)16-27(26(35)30-22-8-10-23(34)11-9-22)18-37-25(31-27)19-6-12-24(13-7-19)36-15-3-14-33/h1-2,4-7,12-13,22-23,33-34H,3,8-11,14-18H2,(H,30,35)/t22?,23?,27-/m1/s1 |
| InChIKey | OQBNSEGFUOKTIN-IJQWPOMLSA-N |
| XLogP | 3.44 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|