C23H25BrN2O4 — CID 23864109
(4R)-4-[(2-bromophenyl)methyl]-N-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864109) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is (4R)-4-[(2-bromophenyl)methyl]-N-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-[(2-bromophenyl)methyl]-N-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864109 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (4R)-4-[(2-bromophenyl)methyl]-N-cyclopropyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1CC1)[C@@]1(Cc2ccccc2Br)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C23H25BrN2O4/c24-20-5-2-1-4-17(20)14-23(22(28)25-18-8-9-18)15-30-21(26-23)16-6-10-19(11-7-16)29-13-3-12-27/h1-2,4-7,10-11,18,27H,3,8-9,12-15H2,(H,25,28)/t23-/m1/s1 |
| InChIKey | AXGMDYMLZHMRKZ-HSZRJFAPSA-N |
| XLogP | 3.25 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|