C33H29BrN2O4 — CID 23835806
(4R)-4-[(4-bromophenyl)methyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835806) has the molecular formula C33H29BrN2O4 and a molecular weight of 597.51 g/mol. Its IUPAC name is (4R)-4-[(4-bromophenyl)methyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-[(4-bromophenyl)methyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835806 |
| Molecular Formula | C33H29BrN2O4 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | (4R)-4-[(4-bromophenyl)methyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1c2ccccc2-c2ccccc21)[C@@]1(Cc2ccc(Br)cc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C33H29BrN2O4/c34-24-14-10-22(11-15-24)20-33(21-40-31(36-33)23-12-16-25(17-13-23)39-19-5-18-37)32(38)35-30-28-8-3-1-6-26(28)27-7-2-4-9-29(27)30/h1-4,6-17,30,37H,5,18-21H2,(H,35,38)/t33-/m1/s1 |
| InChIKey | HJCPMEUHLGYNKN-MGBGTMOVSA-N |
| XLogP | 5.85 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|