C21H23NO5 — CID 24868566
methyl (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate (PubChem CID 24868566) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 24868566 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C21H23NO5/c1-25-20(24)21(14-16-6-3-2-4-7-16)15-27-19(22-21)17-8-10-18(11-9-17)26-13-5-12-23/h2-4,6-11,23H,5,12-15H2,1H3/t21-/m1/s1 |
| InChIKey | FQANEDUFVPIDDO-OAQYLSRUSA-N |
| XLogP | 2.38 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|