C30H34N2O7 — CID 23864108
(4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864108) has the molecular formula C30H34N2O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864108 |
| Molecular Formula | C30H34N2O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (4R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cc(OC)c(CNC(=O)[C@@]2(Cc3ccccc3)COC(c3ccc(OCCCO)cc3)=N2)c(OC)c1 |
| InChI | InChI=1S/C30H34N2O7/c1-35-24-16-26(36-2)25(27(17-24)37-3)19-31-29(34)30(18-21-8-5-4-6-9-21)20-39-28(32-30)22-10-12-23(13-11-22)38-15-7-14-33/h4-6,8-13,16-17,33H,7,14-15,18-20H2,1-3H3,(H,31,34)/t30-/m1/s1 |
| InChIKey | BOGWTLYUWBHGSH-SSEXGKCCSA-N |
| XLogP | 3.55 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|