C21H24BrN3O4 — CID 23975684
(4S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975684) has the molecular formula C21H24BrN3O4 and a molecular weight of 462.34 g/mol. Its IUPAC name is (4S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975684 |
| Molecular Formula | C21H24BrN3O4 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (4S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CNNC(=O)[C@]1(Cc2ccc(Br)cc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C21H24BrN3O4/c1-23-25-20(27)21(13-15-3-7-17(22)8-4-15)14-29-19(24-21)16-5-9-18(10-6-16)28-12-2-11-26/h3-10,23,26H,2,11-14H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | NVAUYELKSDNLBJ-NRFANRHFSA-N |
| XLogP | 2.22 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|