C32H31N5O4 — CID 23835173
(4R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(naphthalen-1-ylmethyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835173) has the molecular formula C32H31N5O4 and a molecular weight of 549.63 g/mol. Its IUPAC name is (4R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(naphthalen-1-ylmethyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(naphthalen-1-ylmethyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835173 |
| Molecular Formula | C32H31N5O4 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | (4R)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-(naphthalen-1-ylmethyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NCc2cccc3ccccc23)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C32H31N5O4/c33-37-35-21-26-9-2-1-8-25(26)19-32(31(39)34-20-27-11-5-10-23-7-3-4-12-29(23)27)22-41-30(36-32)24-13-15-28(16-14-24)40-18-6-17-38/h1-5,7-16,38H,6,17-22H2,(H,34,39)/t32-/m1/s1 |
| InChIKey | CEXGNJCGEKLITG-JGCGQSQUSA-N |
| XLogP | 5.49 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|