C29H31Cl2N3O6S — CID 23975156
(4S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975156) has the molecular formula C29H31Cl2N3O6S and a molecular weight of 620.56 g/mol. Its IUPAC name is (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975156 |
| Molecular Formula | C29H31Cl2N3O6S |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCCc1ccc(Cl)cc1Cl)[C@]1(CCS(=O)(=O)c2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C29H31Cl2N3O6S/c30-23-10-7-21(26(31)19-23)13-15-32-34-28(36)29(14-18-41(37,38)25-5-2-1-3-6-25)20-40-27(33-29)22-8-11-24(12-9-22)39-17-4-16-35/h1-3,5-12,19,32,35H,4,13-18,20H2,(H,34,36)/t29-/m0/s1 |
| InChIKey | AHMNQRBPDASUBI-LJAQVGFWSA-N |
| XLogP | 4.00 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|