C28H31N3O6S — CID 23891649
(4S)-4-[2-(benzenesulfonyl)ethyl]-N'-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891649) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891649 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (4S)-4-[2-(benzenesulfonyl)ethyl]-N'-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCc1ccccc1)[C@]1(CCS(=O)(=O)c2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C28H31N3O6S/c32-17-7-18-36-24-14-12-23(13-15-24)26-30-28(21-37-26,16-19-38(34,35)25-10-5-2-6-11-25)27(33)31-29-20-22-8-3-1-4-9-22/h1-6,8-15,29,32H,7,16-21H2,(H,31,33)/t28-/m0/s1 |
| InChIKey | AXYFODOMUWIZOL-NDEPHWFRSA-N |
| XLogP | 2.65 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|