C23H27FN2O6S — CID 23891336
(4R)-4-[2-(benzenesulfonyl)ethyl]-N-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23891336) has the molecular formula C23H27FN2O6S and a molecular weight of 478.54 g/mol. Its IUPAC name is (4R)-4-[2-(benzenesulfonyl)ethyl]-N-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-N-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23891336 |
| Molecular Formula | C23H27FN2O6S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (4R)-4-[2-(benzenesulfonyl)ethyl]-N-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCF)[C@@]1(CCS(=O)(=O)c2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C23H27FN2O6S/c24-12-13-25-22(28)23(11-16-33(29,30)20-5-2-1-3-6-20)17-32-21(26-23)18-7-9-19(10-8-18)31-15-4-14-27/h1-3,5-10,27H,4,11-17H2,(H,25,28)/t23-/m1/s1 |
| InChIKey | DKTBAZYYEUPZCU-HSZRJFAPSA-N |
| XLogP | 1.91 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|