C29H30FN3O4 — CID 23777170
(4S)-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23777170) has the molecular formula C29H30FN3O4 and a molecular weight of 503.57 g/mol. Its IUPAC name is (4S)-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S)-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23777170 |
| Molecular Formula | C29H30FN3O4 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (4S)-N'-[(2-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCc1ccccc1F)[C@]1(C/C=C/c2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C29H30FN3O4/c30-26-12-5-4-11-24(26)20-31-33-28(35)29(17-6-10-22-8-2-1-3-9-22)21-37-27(32-29)23-13-15-25(16-14-23)36-19-7-18-34/h1-6,8-16,31,34H,7,17-21H2,(H,33,35)/b10-6+/t29-/m0/s1 |
| InChIKey | ZPGRZKUVNQDREJ-FIAZFDOBSA-N |
| XLogP | 4.03 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|