C29H39N3O8 — CID 23891671
tert-butyl 3-[(4S)-4-[[(2,4-dimethoxyphenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23891671) has the molecular formula C29H39N3O8 and a molecular weight of 557.64 g/mol. Its IUPAC name is tert-butyl 3-[(4S)-4-[[(2,4-dimethoxyphenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S)-4-[[(2,4-dimethoxyphenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23891671 |
| Molecular Formula | C29H39N3O8 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | tert-butyl 3-[(4S)-4-[[(2,4-dimethoxyphenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1ccc(CNNC(=O)[C@]2(CCC(=O)OC(C)(C)C)COC(c3ccc(OCCCO)cc3)=N2)c(OC)c1 |
| InChI | InChI=1S/C29H39N3O8/c1-28(2,3)40-25(34)13-14-29(27(35)32-30-18-21-9-12-23(36-4)17-24(21)37-5)19-39-26(31-29)20-7-10-22(11-8-20)38-16-6-15-33/h7-12,17,30,33H,6,13-16,18-19H2,1-5H3,(H,32,35)/t29-/m0/s1 |
| InChIKey | DSYFGQGRWWQKCI-LJAQVGFWSA-N |
| XLogP | 2.92 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|