C33H30Cl2FN3O4 — CID 23778046
(4S,5S)-4-benzyl-5-(2,4-dichlorophenyl)-N'-[(3-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23778046) has the molecular formula C33H30Cl2FN3O4 and a molecular weight of 622.52 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-5-(2,4-dichlorophenyl)-N'-[(3-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-5-(2,4-dichlorophenyl)-N'-[(3-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23778046 |
| Molecular Formula | C33H30Cl2FN3O4 |
| Molecular Weight | 622.52 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | (4S,5S)-4-benzyl-5-(2,4-dichlorophenyl)-N'-[(3-fluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCc1cccc(F)c1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H30Cl2FN3O4/c34-25-12-15-28(29(35)19-25)30-33(20-22-6-2-1-3-7-22,32(41)39-37-21-23-8-4-9-26(36)18-23)38-31(43-30)24-10-13-27(14-11-24)42-17-5-16-40/h1-4,6-15,18-19,30,37,40H,5,16-17,20-21H2,(H,39,41)/t30-,33-/m0/s1 |
| InChIKey | RAYRCCVUQKSOSB-DITALETJSA-N |
| XLogP | 6.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|