C28H27N7O5 — CID 23806154
methyl (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate (PubChem CID 23806154) has the molecular formula C28H27N7O5 and a molecular weight of 541.57 g/mol. Its IUPAC name is methyl (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23806154 |
| Molecular Formula | C28H27N7O5 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | methyl (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2CN=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C28H27N7O5/c1-38-27(37)28(17-20-7-2-3-8-21(20)18-31-34-29)25(23-9-4-5-10-24(23)33-35-30)40-26(32-28)19-11-13-22(14-12-19)39-16-6-15-36/h2-5,7-14,25,36H,6,15-18H2,1H3/t25-,28-/m1/s1 |
| InChIKey | PPJXKCRKHCBIBS-LEAFIULHSA-N |
| XLogP | 5.87 |
| TPSA | 174.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|