C30H31BrN6O5 — CID 23947128
(4S,5S)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-morpholin-4-yl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947128) has the molecular formula C30H31BrN6O5 and a molecular weight of 635.52 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-morpholin-4-yl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-morpholin-4-yl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947128 |
| Molecular Formula | C30H31BrN6O5 |
| Molecular Weight | 635.52 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-4-[(2-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-morpholin-4-yl-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1Br)C(=O)NN1CCOCC1 |
| InChI | InChI=1S/C30H31BrN6O5/c31-25-8-3-1-6-22(25)20-30(29(39)35-37-14-18-40-19-15-37)27(24-7-2-4-9-26(24)34-36-32)42-28(33-30)21-10-12-23(13-11-21)41-17-5-16-38/h1-4,6-13,27,38H,5,14-20H2,(H,35,39)/t27-,30-/m0/s1 |
| InChIKey | MBIGSSAOXIFWOA-FIBWVYCGSA-N |
| XLogP | 5.02 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|