C25H30N6O4 — CID 23863342
(4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23863342) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23863342 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1N=[N+]=[N-])C(=O)NN1CCCC1 |
| InChI | InChI=1S/C25H30N6O4/c1-18-25(24(33)29-31-13-4-5-14-31,17-20-7-2-3-8-22(20)28-30-26)27-23(35-18)19-9-11-21(12-10-19)34-16-6-15-32/h2-3,7-12,18,32H,4-6,13-17H2,1H3,(H,29,33)/t18-,25-/m0/s1 |
| InChIKey | RUTDRSFTPIXGLP-BVZFJXPGSA-N |
| XLogP | 3.66 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|