C24H29N5O6 — CID 23947883
(4R,5R)-4-[(2-azidophenyl)methyl]-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947883) has the molecular formula C24H29N5O6 and a molecular weight of 483.53 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947883 |
| Molecular Formula | C24H29N5O6 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(Cc1ccccc1N=[N+]=[N-])C(=O)NC(CO)CO |
| InChI | InChI=1S/C24H29N5O6/c1-16-24(23(33)26-19(14-31)15-32,13-18-5-2-3-6-21(18)28-29-25)27-22(35-16)17-7-9-20(10-8-17)34-12-4-11-30/h2-3,5-10,16,19,30-32H,4,11-15H2,1H3,(H,26,33)/t16-,24-/m1/s1 |
| InChIKey | KECMYZYJVAKYCW-VOIUYBSRSA-N |
| XLogP | 2.01 |
| TPSA | 169.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|