C31H33N5O6 — CID 23777441
(4R,5R)-5-(2-azidophenyl)-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23777441) has the molecular formula C31H33N5O6 and a molecular weight of 571.63 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23777441 |
| Molecular Formula | C31H33N5O6 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-N-(1,3-dihydroxypropan-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(C/C=C/c1ccccc1)C(=O)NC(CO)CO |
| InChI | InChI=1S/C31H33N5O6/c32-36-35-27-12-5-4-11-26(27)28-31(30(40)33-24(20-38)21-39,17-6-10-22-8-2-1-3-9-22)34-29(42-28)23-13-15-25(16-14-23)41-19-7-18-37/h1-6,8-16,24,28,37-39H,7,17-21H2,(H,33,40)/b10-6+/t28-,31-/m1/s1 |
| InChIKey | IAOZIOIJBYTURY-NNOVNTLCSA-N |
| XLogP | 4.22 |
| TPSA | 169.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|