C30H32N6O4 — CID 23864075
(4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N',N'-dimethyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23864075) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N',N'-dimethyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N',N'-dimethyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23864075 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N',N'-dimethyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CN(C)NC(=O)[C@@]1(C/C=C/c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C30H32N6O4/c1-36(2)34-29(38)30(19-8-12-22-10-4-3-5-11-22)27(25-13-6-7-14-26(25)33-35-31)40-28(32-30)23-15-17-24(18-16-23)39-21-9-20-37/h3-8,10-18,27,37H,9,19-21H2,1-2H3,(H,34,38)/b12-8+/t27-,30-/m0/s1 |
| InChIKey | CZWZHMVVETWCSK-WHXDXNHGSA-N |
| XLogP | 5.34 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|