C38H39N5O7 — CID 23948074
(4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23948074) has the molecular formula C38H39N5O7 and a molecular weight of 677.76 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23948074 |
| Molecular Formula | C38H39N5O7 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-N-[(2,4,6-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cc(OC)c(CNC(=O)[C@]2(C/C=C/c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@@H]2c2ccccc2N=[N+]=[N-])c(OC)c1 |
| InChI | InChI=1S/C38H39N5O7/c1-46-29-23-33(47-2)31(34(24-29)48-3)25-40-37(45)38(20-9-13-26-11-5-4-6-12-26)35(30-14-7-8-15-32(30)42-43-39)50-36(41-38)27-16-18-28(19-17-27)49-22-10-21-44/h4-9,11-19,23-24,35,44H,10,20-22,25H2,1-3H3,(H,40,45)/b13-9+/t35-,38-/m1/s1 |
| InChIKey | XJAVUGWFJVWRBA-WOPLDHMESA-N |
| XLogP | 7.09 |
| TPSA | 156.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|