C29H27F2N5O4 — CID 23778318
(4R,5R)-5-(2-azidophenyl)-N-[(2,6-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778318) has the molecular formula C29H27F2N5O4 and a molecular weight of 547.56 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-N-[(2,6-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-N-[(2,6-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778318 |
| Molecular Formula | C29H27F2N5O4 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-N-[(2,6-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)NCc2c(F)cccc2F)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C29H27F2N5O4/c1-2-15-29(28(38)33-18-22-23(30)8-5-9-24(22)31)26(21-7-3-4-10-25(21)35-36-32)40-27(34-29)19-11-13-20(14-12-19)39-17-6-16-37/h2-5,7-14,26,37H,1,6,15-18H2,(H,33,38)/t26-,29-/m1/s1 |
| InChIKey | MIUPONMQSKDBOG-GGXMVOPNSA-N |
| XLogP | 5.82 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|