C25H29BrN2O4 — CID 23920154
(4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-N-propyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23920154) has the molecular formula C25H29BrN2O4 and a molecular weight of 501.42 g/mol. Its IUPAC name is (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-N-propyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-N-propyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23920154 |
| Molecular Formula | C25H29BrN2O4 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-N-propyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)NCCC)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C25H29BrN2O4/c1-3-14-25(24(30)27-15-4-2)22(20-8-5-6-9-21(20)26)32-23(28-25)18-10-12-19(13-11-18)31-17-7-16-29/h3,5-6,8-13,22,29H,1,4,7,14-17H2,2H3,(H,27,30)/t22-,25-/m1/s1 |
| InChIKey | OYTSEJPRLCOBKY-RCZVLFRGSA-N |
| XLogP | 4.57 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|