C24H27BrN2O4 — CID 23976126
(4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N,N-dimethyl-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23976126) has the molecular formula C24H27BrN2O4 and a molecular weight of 487.39 g/mol. Its IUPAC name is (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N,N-dimethyl-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N,N-dimethyl-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23976126 |
| Molecular Formula | C24H27BrN2O4 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (4R,5R)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N,N-dimethyl-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)N(C)C)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C24H27BrN2O4/c1-4-14-24(23(29)27(2)3)21(19-8-5-6-9-20(19)25)31-22(26-24)17-10-12-18(13-11-17)30-16-7-15-28/h4-6,8-13,21,28H,1,7,14-16H2,2-3H3/t21-,24-/m1/s1 |
| InChIKey | RUVMHGURUWRHAA-ZJSXRUAMSA-N |
| XLogP | 4.13 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|