C29H36BrN3O5 — CID 23748963
(4S,5S)-5-(2-bromophenyl)-N'-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748963) has the molecular formula C29H36BrN3O5 and a molecular weight of 586.53 g/mol. Its IUPAC name is (4S,5S)-5-(2-bromophenyl)-N'-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-bromophenyl)-N'-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748963 |
| Molecular Formula | C29H36BrN3O5 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | (4S,5S)-5-(2-bromophenyl)-N'-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCC2(O)CCCCC2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C29H36BrN3O5/c1-2-15-29(27(35)33-31-20-28(36)16-6-3-7-17-28)25(23-9-4-5-10-24(23)30)38-26(32-29)21-11-13-22(14-12-21)37-19-8-18-34/h2,4-5,9-14,25,31,34,36H,1,3,6-8,15-20H2,(H,33,35)/t25-,29-/m0/s1 |
| InChIKey | RXTWXUCQYNOLSQ-SVEHJYQDSA-N |
| XLogP | 4.36 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|