C32H36N8O4+2 — CID 91275733
[2-[4-(azepane-1-carbonyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(iminoazaniumylideneamino)phenyl]methyl]-5H-1,3-oxazol-5-yl]phenyl]imino-iminoazanium (PubChem CID 91275733) has the molecular formula C32H36N8O4+2 and a molecular weight of 596.69 g/mol. Its IUPAC name is [2-[4-(azepane-1-carbonyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(iminoazaniumylideneamino)phenyl]methyl]-5H-1,3-oxazol-5-yl]phenyl]imino-iminoazanium.
| Compound Name | [2-[4-(azepane-1-carbonyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(iminoazaniumylideneamino)phenyl]methyl]-5H-1,3-oxazol-5-yl]phenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 91275733 |
| Molecular Formula | C32H36N8O4+2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | [2-[4-(azepane-1-carbonyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[2-(iminoazaniumylideneamino)phenyl]methyl]-5H-1,3-oxazol-5-yl]phenyl]imino-iminoazanium |
| SMILES | N=[N+]=Nc1ccccc1CC1(C(=O)N2CCCCCC2)N=C(c2ccc(OCCCO)cc2)OC1c1ccccc1N=[N+]=N |
| InChI | InChI=1S/C32H36N8O4/c33-38-36-27-12-5-3-10-24(27)22-32(31(42)40-18-7-1-2-8-19-40)29(26-11-4-6-13-28(26)37-39-34)44-30(35-32)23-14-16-25(17-15-23)43-21-9-20-41/h3-6,10-17,29,33-34,41H,1-2,7-9,18-22H2/q+2 |
| InChIKey | ZBPOUTDQIZTXJI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|