C33H35N5O4 — CID 23748374
[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 23748374) has the molecular formula C33H35N5O4 and a molecular weight of 565.67 g/mol. Its IUPAC name is [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 23748374 |
| Molecular Formula | C33H35N5O4 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(C/C=C/c1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C33H35N5O4/c34-37-35-24-27-13-4-5-14-29(27)30-33(32(40)38-20-6-7-21-38,19-8-12-25-10-2-1-3-11-25)36-31(42-30)26-15-17-28(18-16-26)41-23-9-22-39/h1-5,8,10-18,30,39H,6-7,9,19-24H2/b12-8+/t30-,33-/m1/s1 |
| InChIKey | GZDUBKLHBFFOHV-UVRYTIJLSA-N |
| XLogP | 6.24 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|