C32H34N8O5 — CID 23919104
[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 23919104) has the molecular formula C32H34N8O5 and a molecular weight of 610.68 g/mol. Its IUPAC name is [(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23919104 |
| Molecular Formula | C32H34N8O5 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | [(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)N2CCOCC2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C32H34N8O5/c33-38-35-21-25-7-2-1-6-24(25)20-32(31(42)40-14-18-43-19-15-40)29(28-9-4-3-8-26(28)22-36-39-34)45-30(37-32)23-10-12-27(13-11-23)44-17-5-16-41/h1-4,6-13,29,41H,5,14-22H2/t29-,32-/m0/s1 |
| InChIKey | AXXWLHYVMPUNNH-NYDCQLBNSA-N |
| XLogP | 5.43 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|