C27H31N5O5 — CID 23748574
[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 23748574) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23748574 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | C=CC[C@@]1(C(=O)N2CCOCC2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C27H31N5O5/c1-2-12-27(26(34)32-13-17-35-18-14-32)24(23-7-4-3-6-21(23)19-29-31-28)37-25(30-27)20-8-10-22(11-9-20)36-16-5-15-33/h2-4,6-11,24,33H,1,5,12-19H2/t24-,27-/m1/s1 |
| InChIKey | SZYHMPISZUAREI-SHQCIBLASA-N |
| XLogP | 3.95 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|