C30H30BrN5O5 — CID 23749286
[(4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 23749286) has the molecular formula C30H30BrN5O5 and a molecular weight of 620.50 g/mol. Its IUPAC name is [(4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23749286 |
| Molecular Formula | C30H30BrN5O5 |
| Molecular Weight | 620.50 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | [(4R,5R)-4-[(2-azidophenyl)methyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@@]1(C(=O)N2CCOCC2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H30BrN5O5/c31-24-10-6-21(7-11-24)27-30(29(38)36-14-18-39-19-15-36,20-23-4-1-2-5-26(23)34-35-32)33-28(41-27)22-8-12-25(13-9-22)40-17-3-16-37/h1-2,4-13,27,37H,3,14-20H2/t27-,30-/m1/s1 |
| InChIKey | MSTHUMDWPUHRAY-POURPWNDSA-N |
| XLogP | 5.51 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|