C36H36N2O5 — CID 23891427
[(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 23891427) has the molecular formula C36H36N2O5 and a molecular weight of 576.69 g/mol. Its IUPAC name is [(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 23891427 |
| Molecular Formula | C36H36N2O5 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H36N2O5/c39-22-7-23-42-32-18-16-31(17-19-32)34-37-36(26-27-8-3-1-4-9-27,35(40)38-20-24-41-25-21-38)33(43-34)30-14-12-29(13-15-30)28-10-5-2-6-11-28/h1-6,8-19,33,39H,7,20-26H2/t33-,36-/m1/s1 |
| InChIKey | MJQDAUUGUJORLY-YYFXGUOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|