C37H39N3O4 — CID 23891298
(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N-piperidin-1-yl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23891298) has the molecular formula C37H39N3O4 and a molecular weight of 589.74 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N-piperidin-1-yl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N-piperidin-1-yl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23891298 |
| Molecular Formula | C37H39N3O4 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-N-piperidin-1-yl-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NN1CCCCC1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H39N3O4/c41-25-10-26-43-33-21-19-32(20-22-33)35-38-37(27-28-11-4-1-5-12-28,36(42)39-40-23-8-3-9-24-40)34(44-35)31-17-15-30(16-18-31)29-13-6-2-7-14-29/h1-2,4-7,11-22,34,41H,3,8-10,23-27H2,(H,39,42)/t34-,37-/m0/s1 |
| InChIKey | JDEBSJFKRMDAQA-UNVMMQEESA-N |
| XLogP | 6.13 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|