C30H32BrN3O4 — CID 23748206
(4S,5S)-4-benzyl-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23748206) has the molecular formula C30H32BrN3O4 and a molecular weight of 578.51 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-benzyl-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23748206 |
| Molecular Formula | C30H32BrN3O4 |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | (4S,5S)-4-benzyl-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-pyrrolidin-1-yl-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NN1CCCC1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H32BrN3O4/c31-25-13-9-23(10-14-25)27-30(21-22-7-2-1-3-8-22,29(36)33-34-17-4-5-18-34)32-28(38-27)24-11-15-26(16-12-24)37-20-6-19-35/h1-3,7-16,27,35H,4-6,17-21H2,(H,33,36)/t27-,30-/m0/s1 |
| InChIKey | HNCOXSJSIBEDPT-FIBWVYCGSA-N |
| XLogP | 4.84 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|