C32H29BrN2O5 — CID 23947820
(4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947820) has the molecular formula C32H29BrN2O5 and a molecular weight of 601.50 g/mol. Its IUPAC name is (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947820 |
| Molecular Formula | C32H29BrN2O5 |
| Molecular Weight | 601.50 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | (4S,5S)-4-[(4-bromophenyl)methyl]-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)[C@@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H29BrN2O5/c33-27-15-7-22(8-16-27)21-32(31(37)35-38)29(25-11-9-24(10-12-25)23-5-2-1-3-6-23)40-30(34-32)26-13-17-28(18-14-26)39-20-4-19-36/h1-3,5-18,29,36,38H,4,19-21H2,(H,35,37)/t29-,32-/m0/s1 |
| InChIKey | JZHRUFWOBIYPAB-NYDCQLBNSA-N |
| XLogP | 5.88 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|